C17H16Cl2N2O2 — CID 166335688
[4-(4-chlorophenoxy)piperidin-1-yl]-(3-chloro-2-pyridinyl)methanone (PubChem CID 166335688) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)piperidin-1-yl]-(3-chloro-2-pyridinyl)methanone.
| Compound Name | [4-(4-chlorophenoxy)piperidin-1-yl]-(3-chloro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 166335688 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [4-(4-chlorophenoxy)piperidin-1-yl]-(3-chloro-2-pyridinyl)methanone |
| SMILES | O=C(c1ncccc1Cl)N1CCC(Oc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-12-3-5-13(6-4-12)23-14-7-10-21(11-8-14)17(22)16-15(19)2-1-9-20-16/h1-6,9,14H,7-8,10-11H2 |
| InChIKey | KPYQGELSURWTBP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |