C27H34O3Si — CID 11293453
tert-butyl-[(7-ethenyl-6-methyl-10-prop-2-enoxy-2,3-dihydro-1H-indeno[5,4-f][1]benzofuran-3-yl)oxy]-dimethylsilane (PubChem CID 11293453) has the molecular formula C27H34O3Si and a molecular weight of 434.65 g/mol. Its IUPAC name is tert-butyl-[(7-ethenyl-6-methyl-10-prop-2-enoxy-2,3-dihydro-1H-indeno[5,4-f][1]benzofuran-3-yl)oxy]-dimethylsilane.
| Compound Name | tert-butyl-[(7-ethenyl-6-methyl-10-prop-2-enoxy-2,3-dihydro-1H-indeno[5,4-f][1]benzofuran-3-yl)oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11293453 |
| Molecular Formula | C27H34O3Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | tert-butyl-[(7-ethenyl-6-methyl-10-prop-2-enoxy-2,3-dihydro-1H-indeno[5,4-f][1]benzofuran-3-yl)oxy]-dimethylsilane |
| SMILES | C=CCOc1c2occ(C=C)c2c(C)c2ccc3c(c12)CCC3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H34O3Si/c1-9-15-28-26-24-19(17(3)23-18(10-2)16-29-25(23)26)11-12-20-21(24)13-14-22(20)30-31(7,8)27(4,5)6/h9-12,16,22H,1-2,13-15H2,3-8H3 |
| InChIKey | HTOCMNZGVMHYJV-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|