C13H26O2Si — CID 101029162
2,2-dimethyl-1-[(1S,2R)-2-trimethylsilyloxycyclopentyl]propan-1-one (PubChem CID 101029162) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is 2,2-dimethyl-1-[(1S,2R)-2-trimethylsilyloxycyclopentyl]propan-1-one.
| Compound Name | 2,2-dimethyl-1-[(1S,2R)-2-trimethylsilyloxycyclopentyl]propan-1-one |
|---|---|
| PubChem CID | 101029162 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2,2-dimethyl-1-[(1S,2R)-2-trimethylsilyloxycyclopentyl]propan-1-one |
| SMILES | CC(C)(C)C(=O)[C@H]1CCC[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-13(2,3)12(14)10-8-7-9-11(10)15-16(4,5)6/h10-11H,7-9H2,1-6H3/t10-,11+/m0/s1 |
| InChIKey | GEMWBQGRUOMDAY-WDEREUQCSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|