C10H20O2Si — CID 15524463
1-[(1R,2R)-2-trimethylsilyloxycyclopentyl]ethanone (PubChem CID 15524463) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is 1-[(1R,2R)-2-trimethylsilyloxycyclopentyl]ethanone.
| Compound Name | 1-[(1R,2R)-2-trimethylsilyloxycyclopentyl]ethanone |
|---|---|
| PubChem CID | 15524463 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-[(1R,2R)-2-trimethylsilyloxycyclopentyl]ethanone |
| SMILES | CC(=O)[C@@H]1CCC[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C10H20O2Si/c1-8(11)9-6-5-7-10(9)12-13(2,3)4/h9-10H,5-7H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | QJQJCWHFFMTJJI-VHSXEESVSA-N |
| XLogP | 2.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|