C19H38N4O3Si — CID 175821071
2,2-dimethylhexan-3-yl (3S,4R)-3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 175821071) has the molecular formula C19H38N4O3Si and a molecular weight of 398.62 g/mol. Its IUPAC name is 2,2-dimethylhexan-3-yl (3S,4R)-3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | 2,2-dimethylhexan-3-yl (3S,4R)-3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175821071 |
| Molecular Formula | C19H38N4O3Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 2,2-dimethylhexan-3-yl (3S,4R)-3-azido-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | CCCC(OC(=O)N1C[C@H](N=[N+]=[N-])[C@H](O[Si](C)(C)C(C)(C)C)C1)C(C)(C)C |
| InChI | InChI=1S/C19H38N4O3Si/c1-10-11-16(18(2,3)4)25-17(24)23-12-14(21-22-20)15(13-23)26-27(8,9)19(5,6)7/h14-16H,10-13H2,1-9H3/t14-,15+,16?/m0/s1 |
| InChIKey | OCASFBVPFWRJRM-QMRHZFGWSA-N |
| XLogP | 5.72 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|