C22H39N7O7Si — CID 174110466
methyl (2S,4S,5R)-5-acetamido-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxane-2-carboxylate (PubChem CID 174110466) has the molecular formula C22H39N7O7Si and a molecular weight of 541.68 g/mol. Its IUPAC name is methyl (2S,4S,5R)-5-acetamido-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R)-5-acetamido-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 174110466 |
| Molecular Formula | C22H39N7O7Si |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.27 |
| IUPAC Name | methyl (2S,4S,5R)-5-acetamido-2,3-diazido-6-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methyloxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N=[N+]=[N-])OC([C@H](O[Si](C)(C)C(C)(C)C)[C@H]2COC(C)(C)O2)[C@H](NC(C)=O)[C@H](C)C1N=[N+]=[N-] |
| InChI | InChI=1S/C22H39N7O7Si/c1-12-15(25-13(2)30)17(35-22(27-29-24,19(31)32-8)18(12)26-28-23)16(14-11-33-21(6,7)34-14)36-37(9,10)20(3,4)5/h12,14-18H,11H2,1-10H3,(H,25,30)/t12-,14+,15+,16+,17?,18?,22-/m0/s1 |
| InChIKey | ZNAZRELMURJCRX-MSMQLPMTSA-N |
| XLogP | 3.93 |
| TPSA | 189.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|