C34H57NO10Si — CID 11377348
methyl (2S,4S,5S,6R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxy-6-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(5-phenylmethoxypentoxy)methyl]-2-methoxyoxane-2-carboxylate (PubChem CID 11377348) has the molecular formula C34H57NO10Si and a molecular weight of 667.91 g/mol. Its IUPAC name is methyl (2S,4S,5S,6R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxy-6-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(5-phenylmethoxypentoxy)methyl]-2-methoxyoxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5S,6R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxy-6-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(5-phenylmethoxypentoxy)methyl]-2-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11377348 |
| Molecular Formula | C34H57NO10Si |
| Molecular Weight | 667.91 g/mol |
| Exact Mass | 667.38 |
| IUPAC Name | methyl (2S,4S,5S,6R)-5-acetamido-4-[tert-butyl(dimethyl)silyl]oxy-6-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-(5-phenylmethoxypentoxy)methyl]-2-methoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(C)=O)[C@H]([C@H](OCCCCCOCc2ccccc2)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C34H57NO10Si/c1-24(36)35-28-26(45-46(9,10)32(2,3)4)21-34(39-8,31(37)38-7)44-30(28)29(27-23-42-33(5,6)43-27)41-20-16-12-15-19-40-22-25-17-13-11-14-18-25/h11,13-14,17-18,26-30H,12,15-16,19-23H2,1-10H3,(H,35,36)/t26-,27+,28+,29+,30+,34-/m0/s1 |
| InChIKey | DMPFLCDGVRLGMF-YTZAACTGSA-N |
| XLogP | 5.11 |
| TPSA | 120.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.91 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|