C22H41NO9Si — CID 68551838
(4S,5R,6R)-5-(2-amino-2-oxoethyl)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-methoxymethyl]-2-methoxyoxane-2-carboxylic acid (PubChem CID 68551838) has the molecular formula C22H41NO9Si and a molecular weight of 491.65 g/mol. Its IUPAC name is (4S,5R,6R)-5-(2-amino-2-oxoethyl)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-methoxymethyl]-2-methoxyoxane-2-carboxylic acid.
| Compound Name | (4S,5R,6R)-5-(2-amino-2-oxoethyl)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-methoxymethyl]-2-methoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 68551838 |
| Molecular Formula | C22H41NO9Si |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | (4S,5R,6R)-5-(2-amino-2-oxoethyl)-4-[tert-butyl(dimethyl)silyl]oxy-6-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-methoxymethyl]-2-methoxyoxane-2-carboxylic acid |
| SMILES | COC([C@H]1COC(C)(C)O1)[C@@H]1OC(OC)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CC(N)=O |
| InChI | InChI=1S/C22H41NO9Si/c1-20(2,3)33(8,9)32-14-11-22(28-7,19(25)26)31-17(13(14)10-16(23)24)18(27-6)15-12-29-21(4,5)30-15/h13-15,17-18H,10-12H2,1-9H3,(H2,23,24)(H,25,26)/t13-,14-,15+,17+,18?,22?/m0/s1 |
| InChIKey | OZIRZSRACDNLGB-CDYSVWANSA-N |
| XLogP | 2.25 |
| TPSA | 135.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|