C34H48O10SSi — CID 10919486
methyl (2R,4S,5S,6R)-6-[(R)-benzoyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 10919486) has the molecular formula C34H48O10SSi and a molecular weight of 676.90 g/mol. Its IUPAC name is methyl (2R,4S,5S,6R)-6-[(R)-benzoyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5S,6R)-6-[(R)-benzoyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 10919486 |
| Molecular Formula | C34H48O10SSi |
| Molecular Weight | 676.90 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | methyl (2R,4S,5S,6R)-6-[(R)-benzoyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COCO[C@H]1[C@H]([C@H](OC(=O)c2ccccc2)[C@H]2COC(C)(C)O2)O[C@](Sc2ccccc2)(C(=O)OC)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H48O10SSi/c1-32(2,3)46(8,9)44-25-20-34(31(36)38-7,45-24-18-14-11-15-19-24)43-29(27(25)39-22-37-6)28(26-21-40-33(4,5)42-26)41-30(35)23-16-12-10-13-17-23/h10-19,25-29H,20-22H2,1-9H3/t25-,26+,27+,28+,29+,34+/m0/s1 |
| InChIKey | PQTYHPQUGBIXDM-XWDKLUHHSA-N |
| XLogP | 6.19 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.90 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|