C19H36F3N3O7SSi2 — CID 11071825
[(1R)-1-[(2S,3R,4S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate (PubChem CID 11071825) has the molecular formula C19H36F3N3O7SSi2 and a molecular weight of 563.74 g/mol. Its IUPAC name is [(1R)-1-[(2S,3R,4S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate.
| Compound Name | [(1R)-1-[(2S,3R,4S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11071825 |
| Molecular Formula | C19H36F3N3O7SSi2 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | [(1R)-1-[(2S,3R,4S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]1OC(=O)[C@@H](N=[N+]=[N-])[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36F3N3O7SSi2/c1-17(2,3)34(7,8)29-11-12(31-33(27,28)19(20,21)22)14-15(13(24-25-23)16(26)30-14)32-35(9,10)18(4,5)6/h12-15H,11H2,1-10H3/t12-,13+,14-,15-/m1/s1 |
| InChIKey | FFMOPDHUVDPWSQ-LXTVHRRPSA-N |
| XLogP | 5.24 |
| TPSA | 136.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|