C13H31N3O5SSi — CID 158383800
(2S)-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentan-1-ol;methanesulfonic acid (PubChem CID 158383800) has the molecular formula C13H31N3O5SSi and a molecular weight of 369.56 g/mol. Its IUPAC name is (2S)-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentan-1-ol;methanesulfonic acid.
| Compound Name | (2S)-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentan-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 158383800 |
| Molecular Formula | C13H31N3O5SSi |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2S)-5-azido-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pentan-1-ol;methanesulfonic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CO)CCCN=[N+]=[N-].CS(=O)(=O)O |
| InChI | InChI=1S/C12H27N3O2Si.CH4O3S/c1-12(2,3)18(4,5)17-10-11(9-16)7-6-8-14-15-13;1-5(2,3)4/h11,16H,6-10H2,1-5H3;1H3,(H,2,3,4)/t11-;/m0./s1 |
| InChIKey | GWCVBPPCEHTMLD-MERQFXBCSA-N |
| XLogP | 3.21 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|