C19H31N3O3SSi — CID 122371913
[(2S,3R,4S,5S)-4-azido-3-methoxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 122371913) has the molecular formula C19H31N3O3SSi and a molecular weight of 409.63 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-4-azido-3-methoxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3R,4S,5S)-4-azido-3-methoxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 122371913 |
| Molecular Formula | C19H31N3O3SSi |
| Molecular Weight | 409.63 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [(2S,3R,4S,5S)-4-azido-3-methoxy-5-(4-methylphenyl)sulfanyloxolan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]1[C@H](N=[N+]=[N-])[C@H](Sc2ccc(C)cc2)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H31N3O3SSi/c1-13-8-10-14(11-9-13)26-18-16(21-22-20)17(23-5)15(25-18)12-24-27(6,7)19(2,3)4/h8-11,15-18H,12H2,1-7H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | OBWFPKBDRIZKSE-XSLAGTTESA-N |
| XLogP | 5.53 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|