C13H24BN3O3Si — CID 90125491
CID 90125491 (PubChem CID 90125491) has the molecular formula C13H24BN3O3Si and a molecular weight of 309.25 g/mol.
| Compound Name | CID 90125491 |
|---|---|
| PubChem CID | 90125491 |
| Molecular Formula | C13H24BN3O3Si |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@@]2(CO[Si](C)(C)C(C)(C)C)COC[C@@H]1[C@@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C13H24BN3O3Si/c1-12(2,3)21(4,5)19-8-13-7-18-6-9(11(14)20-13)10(13)16-17-15/h9-11H,6-8H2,1-5H3/t9-,10+,11-,13-/m1/s1 |
| InChIKey | IMCKNZMOKPIQTH-LSCVPOLPSA-N |
| XLogP | 2.60 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|