C7H11N3O4 — CID 101103543
[(1S,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol (PubChem CID 101103543) has the molecular formula C7H11N3O4 and a molecular weight of 201.18 g/mol. Its IUPAC name is [(1S,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol.
| Compound Name | [(1S,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol |
|---|---|
| PubChem CID | 101103543 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | [(1S,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methanol |
| SMILES | CO[C@H]1O[C@@]2(CO)CO[C@@H]1[C@@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C7H11N3O4/c1-12-6-4-5(9-10-8)7(2-11,14-6)3-13-4/h4-6,11H,2-3H2,1H3/t4-,5+,6+,7+/m1/s1 |
| InChIKey | LXYZUIWOEMGNLY-BWBBJGPYSA-N |
| XLogP | -0.20 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|