C9H13N3O5 — CID 10681674
[(1R,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl acetate (PubChem CID 10681674) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is [(1R,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl acetate.
| Compound Name | [(1R,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl acetate |
|---|---|
| PubChem CID | 10681674 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [(1R,3S,4R,7S)-7-azido-3-methoxy-2,5-dioxabicyclo[2.2.1]heptan-1-yl]methyl acetate |
| SMILES | CO[C@H]1O[C@@]2(COC(C)=O)CO[C@@H]1[C@@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C9H13N3O5/c1-5(13)15-3-9-4-16-6(7(9)11-12-10)8(14-2)17-9/h6-8H,3-4H2,1-2H3/t6-,7+,8+,9+/m1/s1 |
| InChIKey | MGPTWXAZQXWLHE-XGEHTFHBSA-N |
| XLogP | 0.37 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|