C18H35N3O5Si — CID 174153778
[(3aR,6R,7S,7aR)-7-azido-4-ethyl-6-methoxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 174153778) has the molecular formula C18H35N3O5Si and a molecular weight of 401.58 g/mol. Its IUPAC name is [(3aR,6R,7S,7aR)-7-azido-4-ethyl-6-methoxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,6R,7S,7aR)-7-azido-4-ethyl-6-methoxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174153778 |
| Molecular Formula | C18H35N3O5Si |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | [(3aR,6R,7S,7aR)-7-azido-4-ethyl-6-methoxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CCC1(CO[Si](C)(C)C(C)(C)C)O[C@@H](OC)[C@@H](N=[N+]=[N-])[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H35N3O5Si/c1-10-18(11-23-27(8,9)16(2,3)4)14-13(24-17(5,6)25-14)12(20-21-19)15(22-7)26-18/h12-15H,10-11H2,1-9H3/t12-,13+,14+,15+,18?/m0/s1 |
| InChIKey | MTPDKYAIJKMOPY-KKDJAQBXSA-N |
| XLogP | 4.36 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|