C15H28N4O7Si — CID 177447068
[(4aR,6S,7R,8R,8aR)-7-azido-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate (PubChem CID 177447068) has the molecular formula C15H28N4O7Si and a molecular weight of 404.50 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aR)-7-azido-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate.
| Compound Name | [(4aR,6S,7R,8R,8aR)-7-azido-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate |
|---|---|
| PubChem CID | 177447068 |
| Molecular Formula | C15H28N4O7Si |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(4aR,6S,7R,8R,8aR)-7-azido-8-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate |
| SMILES | CC1(C)OC[C@H]2O[C@@H](O[N+](=O)[O-])[C@H](N=[N+]=[N-])[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C15H28N4O7Si/c1-14(2,3)27(6,7)26-12-10(17-18-16)13(25-19(20)21)23-9-8-22-15(4,5)24-11(9)12/h9-13H,8H2,1-7H3/t9-,10-,11-,12-,13+/m1/s1 |
| InChIKey | MADUPPJQPORSMV-VEGXAWMVSA-N |
| XLogP | 3.14 |
| TPSA | 138.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|