C17H30F2O5Si — CID 102586258
[(4aR,6S,8R,8aR)-7-(difluoromethylidene)-6-methoxy-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102586258) has the molecular formula C17H30F2O5Si and a molecular weight of 380.50 g/mol. Its IUPAC name is [(4aR,6S,8R,8aR)-7-(difluoromethylidene)-6-methoxy-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(4aR,6S,8R,8aR)-7-(difluoromethylidene)-6-methoxy-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102586258 |
| Molecular Formula | C17H30F2O5Si |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(4aR,6S,8R,8aR)-7-(difluoromethylidene)-6-methoxy-2,2-dimethyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)C1=C(F)F |
| InChI | InChI=1S/C17H30F2O5Si/c1-16(2,3)25(7,8)24-13-11(14(18)19)15(20-6)22-10-9-21-17(4,5)23-12(10)13/h10,12-13,15H,9H2,1-8H3/t10-,12-,13-,15+/m1/s1 |
| InChIKey | JBUYJZANBMDWPH-OPQSFPLASA-N |
| XLogP | 4.05 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|