C19H38O6Si — CID 10894453
(2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,5-trimethyloxane-3,4-diol (PubChem CID 10894453) has the molecular formula C19H38O6Si and a molecular weight of 390.59 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,5-trimethyloxane-3,4-diol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,5-trimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 10894453 |
| Molecular Formula | C19H38O6Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4,5-trimethyloxane-3,4-diol |
| SMILES | C[C@H]1[C@H]([C@@H]2COC(C)(C)O2)O[C@@H](O[Si](C)(C)C(C)(C)C)[C@](C)(O)[C@]1(C)O |
| InChI | InChI=1S/C19H38O6Si/c1-12-14(13-11-22-17(5,6)24-13)23-15(19(8,21)18(12,7)20)25-26(9,10)16(2,3)4/h12-15,20-21H,11H2,1-10H3/t12-,13-,14+,15-,18+,19-/m0/s1 |
| InChIKey | CZXCUSJGVSVZCD-KHSMQWPDSA-N |
| XLogP | 3.02 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|