C12H22O9 — CID 91845536
(3R,4R,5S)-4-[(2S,3R,4S,5R)-4-hydroxy-3,5-dimethoxyoxan-2-yl]oxy-5-(hydroxymethyl)oxolane-2,3-diol (PubChem CID 91845536) has the molecular formula C12H22O9 and a molecular weight of 310.30 g/mol. Its IUPAC name is (3R,4R,5S)-4-[(2S,3R,4S,5R)-4-hydroxy-3,5-dimethoxyoxan-2-yl]oxy-5-(hydroxymethyl)oxolane-2,3-diol.
| Compound Name | (3R,4R,5S)-4-[(2S,3R,4S,5R)-4-hydroxy-3,5-dimethoxyoxan-2-yl]oxy-5-(hydroxymethyl)oxolane-2,3-diol |
|---|---|
| PubChem CID | 91845536 |
| Molecular Formula | C12H22O9 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (3R,4R,5S)-4-[(2S,3R,4S,5R)-4-hydroxy-3,5-dimethoxyoxan-2-yl]oxy-5-(hydroxymethyl)oxolane-2,3-diol |
| SMILES | CO[C@H]1[C@H](O[C@H]2[C@H](CO)OC(O)[C@@H]2O)OC[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C12H22O9/c1-17-6-4-19-12(10(18-2)7(6)14)21-9-5(3-13)20-11(16)8(9)15/h5-16H,3-4H2,1-2H3/t5-,6+,7-,8+,9-,10+,11?,12-/m0/s1 |
| InChIKey | NIFOANTXJXBDPK-JYDYGREQSA-N |
| XLogP | -2.81 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |