C7H13O6P — CID 147828707
[(E)-2-[(2R,4R)-3-hydroxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid (PubChem CID 147828707) has the molecular formula C7H13O6P and a molecular weight of 224.15 g/mol. Its IUPAC name is [(E)-2-[(2R,4R)-3-hydroxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[(2R,4R)-3-hydroxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 147828707 |
| Molecular Formula | C7H13O6P |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | [(E)-2-[(2R,4R)-3-hydroxy-4-methoxyoxolan-2-yl]ethenyl]phosphonic acid |
| SMILES | CO[C@@H]1CO[C@H](/C=C/P(=O)(O)O)C1O |
| InChI | InChI=1S/C7H13O6P/c1-12-6-4-13-5(7(6)8)2-3-14(9,10)11/h2-3,5-8H,4H2,1H3,(H2,9,10,11)/b3-2+/t5-,6-,7?/m1/s1 |
| InChIKey | AVVCSRCDJMGVFK-XRAGZIJYSA-N |
| XLogP | -0.55 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|