C7H12O4 — CID 154729224
(2S,3R,4R)-3,4-dimethoxyoxolane-2-carbaldehyde (PubChem CID 154729224) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is (2S,3R,4R)-3,4-dimethoxyoxolane-2-carbaldehyde.
| Compound Name | (2S,3R,4R)-3,4-dimethoxyoxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 154729224 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2S,3R,4R)-3,4-dimethoxyoxolane-2-carbaldehyde |
| SMILES | CO[C@H]1[C@@H](C=O)OC[C@H]1OC |
| InChI | InChI=1S/C7H12O4/c1-9-6-4-11-5(3-8)7(6)10-2/h3,5-7H,4H2,1-2H3/t5-,6-,7+/m1/s1 |
| InChIKey | JBUZIWJXAHCNEU-QYNIQEEDSA-N |
| XLogP | -0.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|