C22H27O8P — CID 146367072
[(E)-2-[3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]ethenyl]phosphonic acid (PubChem CID 146367072) has the molecular formula C22H27O8P and a molecular weight of 450.42 g/mol. Its IUPAC name is [(E)-2-[3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]ethenyl]phosphonic acid.
| Compound Name | [(E)-2-[3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]ethenyl]phosphonic acid |
|---|---|
| PubChem CID | 146367072 |
| Molecular Formula | C22H27O8P |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [(E)-2-[3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]ethenyl]phosphonic acid |
| SMILES | COC1OC(/C=C/P(=O)(O)O)C(O)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C22H27O8P/c1-27-22-21(29-15-17-10-6-3-7-11-17)20(28-14-16-8-4-2-5-9-16)19(23)18(30-22)12-13-31(24,25)26/h2-13,18-23H,14-15H2,1H3,(H2,24,25,26)/b13-12+ |
| InChIKey | UJUHEWUAKZFBHX-OUKQBFOZSA-N |
| XLogP | 2.58 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|