C6H11NO5 — CID 163957817
6-methyl-4-nitrosooxane-2,3,5-triol (PubChem CID 163957817) has the molecular formula C6H11NO5 and a molecular weight of 177.16 g/mol. Its IUPAC name is 6-methyl-4-nitrosooxane-2,3,5-triol.
| Compound Name | 6-methyl-4-nitrosooxane-2,3,5-triol |
|---|---|
| PubChem CID | 163957817 |
| Molecular Formula | C6H11NO5 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 6-methyl-4-nitrosooxane-2,3,5-triol |
| SMILES | CC1OC(O)C(O)C(N=O)C1O |
| InChI | InChI=1S/C6H11NO5/c1-2-4(8)3(7-11)5(9)6(10)12-2/h2-6,8-10H,1H3 |
| InChIKey | SEXZQUJDRZBKTG-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |