C7H13NO5 — CID 89010600
2-(hydroxymethyl)-6-methyl-4-nitrosooxane-3,5-diol (PubChem CID 89010600) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-methyl-4-nitrosooxane-3,5-diol.
| Compound Name | 2-(hydroxymethyl)-6-methyl-4-nitrosooxane-3,5-diol |
|---|---|
| PubChem CID | 89010600 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-(hydroxymethyl)-6-methyl-4-nitrosooxane-3,5-diol |
| SMILES | CC1OC(CO)C(O)C(N=O)C1O |
| InChI | InChI=1S/C7H13NO5/c1-3-6(10)5(8-12)7(11)4(2-9)13-3/h3-7,9-11H,2H2,1H3 |
| InChIKey | KYLHDXSGVUTQCL-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |