C6H11NO6 — CID 89164102
6-(hydroxymethyl)-4-nitrosooxane-2,3,5-triol (PubChem CID 89164102) has the molecular formula C6H11NO6 and a molecular weight of 193.16 g/mol. Its IUPAC name is 6-(hydroxymethyl)-4-nitrosooxane-2,3,5-triol.
| Compound Name | 6-(hydroxymethyl)-4-nitrosooxane-2,3,5-triol |
|---|---|
| PubChem CID | 89164102 |
| Molecular Formula | C6H11NO6 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 6-(hydroxymethyl)-4-nitrosooxane-2,3,5-triol |
| SMILES | O=NC1C(O)C(O)OC(CO)C1O |
| InChI | InChI=1S/C6H11NO6/c8-1-2-4(9)3(7-12)5(10)6(11)13-2/h2-6,8-11H,1H2 |
| InChIKey | ZNWPPKWEPYIGDG-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |