C5H9NO4 — CID 139470569
(2S,3R)-5-methyl-4-nitrosooxolane-2,3-diol (PubChem CID 139470569) has the molecular formula C5H9NO4 and a molecular weight of 147.13 g/mol. Its IUPAC name is (2S,3R)-5-methyl-4-nitrosooxolane-2,3-diol.
| Compound Name | (2S,3R)-5-methyl-4-nitrosooxolane-2,3-diol |
|---|---|
| PubChem CID | 139470569 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | (2S,3R)-5-methyl-4-nitrosooxolane-2,3-diol |
| SMILES | CC1O[C@H](O)[C@H](O)C1N=O |
| InChI | InChI=1S/C5H9NO4/c1-2-3(6-9)4(7)5(8)10-2/h2-5,7-8H,1H3/t2?,3?,4-,5+/m1/s1 |
| InChIKey | ZJMYKJYAVSVLNO-CIQQZFMOSA-N |
| XLogP | -0.78 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |