C6H12O5 — CID 147021144
(6S)-2-(hydroxymethyl)-6-methyl-1,3-dioxane-4,5-diol (PubChem CID 147021144) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is (6S)-2-(hydroxymethyl)-6-methyl-1,3-dioxane-4,5-diol.
| Compound Name | (6S)-2-(hydroxymethyl)-6-methyl-1,3-dioxane-4,5-diol |
|---|---|
| PubChem CID | 147021144 |
| Molecular Formula | C6H12O5 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (6S)-2-(hydroxymethyl)-6-methyl-1,3-dioxane-4,5-diol |
| SMILES | C[C@@H]1OC(CO)OC(O)C1O |
| InChI | InChI=1S/C6H12O5/c1-3-5(8)6(9)11-4(2-7)10-3/h3-9H,2H2,1H3/t3-,4?,5?,6?/m0/s1 |
| InChIKey | AVSPBACEGZHHGA-ALMVMMGASA-N |
| XLogP | -1.58 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |