C6H12O3 — CID 58896345
(4,5-dimethyl-1,3-dioxolan-2-yl)methanol (PubChem CID 58896345) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-dioxolan-2-yl)methanol.
| Compound Name | (4,5-dimethyl-1,3-dioxolan-2-yl)methanol |
|---|---|
| PubChem CID | 58896345 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (4,5-dimethyl-1,3-dioxolan-2-yl)methanol |
| SMILES | CC1OC(CO)OC1C |
| InChI | InChI=1S/C6H12O3/c1-4-5(2)9-6(3-7)8-4/h4-7H,3H2,1-2H3 |
| InChIKey | CAFLJLLVACNFEF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |