(4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid

C4H6O6 — CID 45084727

IUPAC(4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid
SMILESO=C(O)C1O[C@H](O)[C@@H](O)O1
InChIInChI=1S/C4H6O6/c5-1(6)4-9-2(7)3(8)10-4/h2-4,7-8H,(H,5,6)/t2-,3-/m0/s1
InChIKeyDKYRLITYAZMMBF-HRFVKAFMSA-N
MW150.09 g/mol
LogP-1.92
Rot. Bonds1

About (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid

(4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid (PubChem CID 45084727) has the molecular formula C4H6O6 and a molecular weight of 150.09 g/mol. Its IUPAC name is (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid.

Molecular Properties

Compound Name(4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid
PubChem CID45084727
Molecular FormulaC4H6O6
Molecular Weight150.09 g/mol
Exact Mass150.02
IUPAC Name(4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid
SMILESO=C(O)C1O[C@H](O)[C@@H](O)O1
InChIInChI=1S/C4H6O6/c5-1(6)4-9-2(7)3(8)10-4/h2-4,7-8H,(H,5,6)/t2-,3-/m0/s1
InChIKeyDKYRLITYAZMMBF-HRFVKAFMSA-N
XLogP-1.92
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.09
LogP ≤ 5-1.92
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid?
The IUPAC name of (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid (CID 45084727) is (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid.
What is the SMILES notation for (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid?
The canonical SMILES for (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid is O=C(O)C1O[C@H](O)[C@@H](O)O1.
What is the InChIKey of (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid?
The InChIKey is DKYRLITYAZMMBF-HRFVKAFMSA-N. The full InChI is InChI=1S/C4H6O6/c5-1(6)4-9-2(7)3(8)10-4/h2-4,7-8H,(H,5,6)/t2-,3-/m0/s1.
What are the key properties of (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid?
(4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid has a molecular weight of 150.09 g/mol, XLogP of -1.92, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4,5-dihydroxy-1,3-dioxolane-2-carboxylic acid is sourced from PubChem (CID 45084727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).