About (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid
(2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid (PubChem CID 160968845) has the molecular formula C8H8O10
and a molecular weight of 264.14 g/mol. Its IUPAC name is (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid.
Molecular Properties
| Compound Name | (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid |
| PubChem CID | 160968845 |
| Molecular Formula | C8H8O10 |
| Molecular Weight | 264.14 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid |
| SMILES | O=COC1OC1C(=O)O.O=CO[C@H]1O[C@@H]1C(=O)O |
| InChI | InChI=1S/2C4H4O5/c2*5-1-8-4-2(9-4)3(6)7/h2*1-2,4H,(H,6,7)/t2-,4+;/m1./s1 |
| InChIKey | SXZKTWSLYHQZAC-ZVYNFJQASA-N |
| XLogP | -2.06 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.14 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid?
The IUPAC name of (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid (CID 160968845) is (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid.
What is the SMILES notation for (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid?
The canonical SMILES for (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid is O=COC1OC1C(=O)O.O=CO[C@H]1O[C@@H]1C(=O)O.
What is the InChIKey of (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid?
The InChIKey is SXZKTWSLYHQZAC-ZVYNFJQASA-N. The full InChI is InChI=1S/2C4H4O5/c2*5-1-8-4-2(9-4)3(6)7/h2*1-2,4H,(H,6,7)/t2-,4+;/m1./s1.
What are the key properties of (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid?
(2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid has a molecular weight of 264.14 g/mol, XLogP of -2.06, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-3-formyloxyoxirane-2-carboxylic acid;3-formyloxyoxirane-2-carboxylic acid is sourced from PubChem (CID 160968845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).