C13H18O9 — CID 156726382
diethyl 3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate (PubChem CID 156726382) has the molecular formula C13H18O9 and a molecular weight of 318.28 g/mol. Its IUPAC name is diethyl 3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate.
| Compound Name | diethyl 3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate |
|---|---|
| PubChem CID | 156726382 |
| Molecular Formula | C13H18O9 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | diethyl 3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-4,11-dicarboxylate |
| SMILES | CCOC(=O)C1OCC2OC3OC(C(=O)OCC)OC3C2O1 |
| InChI | InChI=1S/C13H18O9/c1-3-16-9(14)12-18-5-6-7(20-12)8-11(19-6)22-13(21-8)10(15)17-4-2/h6-8,11-13H,3-5H2,1-2H3 |
| InChIKey | MVNRGOLVJFIEED-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |