C10H16O6 — CID 23240878
ethyl 2-[(1S,5R,7S)-7-(hydroxymethyl)-3,6,8-trioxabicyclo[3.2.1]octan-4-yl]acetate (PubChem CID 23240878) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is ethyl 2-[(1S,5R,7S)-7-(hydroxymethyl)-3,6,8-trioxabicyclo[3.2.1]octan-4-yl]acetate.
| Compound Name | ethyl 2-[(1S,5R,7S)-7-(hydroxymethyl)-3,6,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
|---|---|
| PubChem CID | 23240878 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | ethyl 2-[(1S,5R,7S)-7-(hydroxymethyl)-3,6,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
| SMILES | CCOC(=O)CC1OC[C@@H]2O[C@H]1O[C@H]2CO |
| InChI | InChI=1S/C10H16O6/c1-2-13-9(12)3-6-10-15-7(4-11)8(16-10)5-14-6/h6-8,10-11H,2-5H2,1H3/t6?,7-,8-,10+/m0/s1 |
| InChIKey | ZSFLHAKBGSDZHD-YUIXYCCVSA-N |
| XLogP | -0.56 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |