C17H24O4 — CID 135013293
ethyl 2-[(1S,10R,12R)-11,15-dioxapentacyclo[6.6.1.02,7.03,12.04,9]pentadecan-10-yl]acetate (PubChem CID 135013293) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 2-[(1S,10R,12R)-11,15-dioxapentacyclo[6.6.1.02,7.03,12.04,9]pentadecan-10-yl]acetate.
| Compound Name | ethyl 2-[(1S,10R,12R)-11,15-dioxapentacyclo[6.6.1.02,7.03,12.04,9]pentadecan-10-yl]acetate |
|---|---|
| PubChem CID | 135013293 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethyl 2-[(1S,10R,12R)-11,15-dioxapentacyclo[6.6.1.02,7.03,12.04,9]pentadecan-10-yl]acetate |
| SMILES | CCOC(=O)CC1O[C@@H]2CC[C@@H]3OC4C5CCC(C14)C2C53 |
| InChI | InChI=1S/C17H24O4/c1-2-19-13(18)7-12-16-8-3-4-9-15-11(21-17(9)16)6-5-10(20-12)14(8)15/h8-12,14-17H,2-7H2,1H3/t8?,9?,10-,11+,12?,14?,15?,16?,17?/m1/s1 |
| InChIKey | YIRSOPWRLBJOQV-YJRNFISWSA-N |
| XLogP | 2.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |