C16H26O5 — CID 10827947
ethyl (2R,3S)-3-(2-ethoxy-2-oxoethyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-carboxylate (PubChem CID 10827947) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is ethyl (2R,3S)-3-(2-ethoxy-2-oxoethyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-(2-ethoxy-2-oxoethyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 10827947 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | ethyl (2R,3S)-3-(2-ethoxy-2-oxoethyl)-2-methyl-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)C[C@H]1C2CCCCC2O[C@@]1(C)C(=O)OCC |
| InChI | InChI=1S/C16H26O5/c1-4-19-14(17)10-12-11-8-6-7-9-13(11)21-16(12,3)15(18)20-5-2/h11-13H,4-10H2,1-3H3/t11?,12-,13?,16+/m0/s1 |
| InChIKey | XKUSENLDEMXNJR-SPFUSLPCSA-N |
| XLogP | 2.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |