C12H20O5 — CID 101432607
ethyl 2-[(1S,4S,5R)-1-propan-2-yl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate (PubChem CID 101432607) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is ethyl 2-[(1S,4S,5R)-1-propan-2-yl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate.
| Compound Name | ethyl 2-[(1S,4S,5R)-1-propan-2-yl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
|---|---|
| PubChem CID | 101432607 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | ethyl 2-[(1S,4S,5R)-1-propan-2-yl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1OO[C@]2(C(C)C)CC[C@H]1O2 |
| InChI | InChI=1S/C12H20O5/c1-4-14-11(13)7-10-9-5-6-12(15-9,8(2)3)17-16-10/h8-10H,4-7H2,1-3H3/t9-,10+,12+/m1/s1 |
| InChIKey | QXFRYXZWBPXDAV-SCVCMEIPSA-N |
| XLogP | 1.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|