C15H18O5 — CID 134928065
benzyl 2-[(1S,4R,5S)-1-methyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate (PubChem CID 134928065) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is benzyl 2-[(1S,4R,5S)-1-methyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate.
| Compound Name | benzyl 2-[(1S,4R,5S)-1-methyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
|---|---|
| PubChem CID | 134928065 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | benzyl 2-[(1S,4R,5S)-1-methyl-2,3,8-trioxabicyclo[3.2.1]octan-4-yl]acetate |
| SMILES | C[C@]12CC[C@H](O1)[C@@H](CC(=O)OCc1ccccc1)OO2 |
| InChI | InChI=1S/C15H18O5/c1-15-8-7-12(18-15)13(19-20-15)9-14(16)17-10-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/t12-,13+,15-/m0/s1 |
| InChIKey | GUGMNXSMBFTBCD-GUTXKFCHSA-N |
| XLogP | 2.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|