C18H28O7 — CID 15416995
ethyl 2-[(1S,3R,5S,6R,8S,10R,12S,17R)-5-hydroxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]acetate (PubChem CID 15416995) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is ethyl 2-[(1S,3R,5S,6R,8S,10R,12S,17R)-5-hydroxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]acetate.
| Compound Name | ethyl 2-[(1S,3R,5S,6R,8S,10R,12S,17R)-5-hydroxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]acetate |
|---|---|
| PubChem CID | 15416995 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | ethyl 2-[(1S,3R,5S,6R,8S,10R,12S,17R)-5-hydroxy-2,7,11,16-tetraoxatetracyclo[8.8.0.03,8.012,17]octadecan-6-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1O[C@H]2C[C@H]3O[C@H]4CCCO[C@@H]4C[C@@H]3O[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C18H28O7/c1-2-21-18(20)9-12-10(19)6-14-16(24-12)8-17-15(25-14)7-13-11(23-17)4-3-5-22-13/h10-17,19H,2-9H2,1H3/t10-,11-,12+,13+,14+,15-,16-,17+/m0/s1 |
| InChIKey | BEZHJKQIUNZGKY-YHVZMVIRSA-N |
| XLogP | 0.95 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |