C18H22O6 — CID 10688135
[(2R,3R,4aR,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] benzoate (PubChem CID 10688135) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is [(2R,3R,4aR,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] benzoate.
| Compound Name | [(2R,3R,4aR,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] benzoate |
|---|---|
| PubChem CID | 10688135 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(2R,3R,4aR,8aR)-2-(2-methoxy-2-oxoethyl)-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] benzoate |
| SMILES | COC(=O)C[C@H]1O[C@@H]2CCCO[C@@H]2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O6/c1-21-17(19)11-16-15(10-14-13(23-16)8-5-9-22-14)24-18(20)12-6-3-2-4-7-12/h2-4,6-7,13-16H,5,8-11H2,1H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | YHMJSZRBMJKPKY-KLHDSHLOSA-N |
| XLogP | 2.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |