C15H18O4 — CID 101372581
[(2S,3R)-2-phenacyloxan-3-yl] acetate (PubChem CID 101372581) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is [(2S,3R)-2-phenacyloxan-3-yl] acetate.
| Compound Name | [(2S,3R)-2-phenacyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 101372581 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [(2S,3R)-2-phenacyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCCO[C@H]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O4/c1-11(16)19-14-8-5-9-18-15(14)10-13(17)12-6-3-2-4-7-12/h2-4,6-7,14-15H,5,8-10H2,1H3/t14-,15+/m1/s1 |
| InChIKey | HNYHFZKRBVJODO-CABCVRRESA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |