C18H25BrO4 — CID 56959018
[(2R,4S,5R,8S)-8-[(1S)-1-bromopropyl]-5-hydroxy-2-methyloxocan-4-yl] benzoate (PubChem CID 56959018) has the molecular formula C18H25BrO4 and a molecular weight of 385.30 g/mol. Its IUPAC name is [(2R,4S,5R,8S)-8-[(1S)-1-bromopropyl]-5-hydroxy-2-methyloxocan-4-yl] benzoate.
| Compound Name | [(2R,4S,5R,8S)-8-[(1S)-1-bromopropyl]-5-hydroxy-2-methyloxocan-4-yl] benzoate |
|---|---|
| PubChem CID | 56959018 |
| Molecular Formula | C18H25BrO4 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [(2R,4S,5R,8S)-8-[(1S)-1-bromopropyl]-5-hydroxy-2-methyloxocan-4-yl] benzoate |
| SMILES | CC[C@H](Br)[C@@H]1CC[C@@H](O)[C@@H](OC(=O)c2ccccc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C18H25BrO4/c1-3-14(19)16-10-9-15(20)17(11-12(2)22-16)23-18(21)13-7-5-4-6-8-13/h4-8,12,14-17,20H,3,9-11H2,1-2H3/t12-,14+,15-,16+,17+/m1/s1 |
| InChIKey | IPULHLZXHSQQBE-SOKJMZBUSA-N |
| XLogP | 3.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|