C20H22O4 — CID 135013294
ethyl 2-[(3R,5S,12R)-4,18-dioxahexacyclo[10.5.1.02,15.05,14.06,11.013,17]octadeca-6,8,10-trien-3-yl]acetate (PubChem CID 135013294) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is ethyl 2-[(3R,5S,12R)-4,18-dioxahexacyclo[10.5.1.02,15.05,14.06,11.013,17]octadeca-6,8,10-trien-3-yl]acetate.
| Compound Name | ethyl 2-[(3R,5S,12R)-4,18-dioxahexacyclo[10.5.1.02,15.05,14.06,11.013,17]octadeca-6,8,10-trien-3-yl]acetate |
|---|---|
| PubChem CID | 135013294 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | ethyl 2-[(3R,5S,12R)-4,18-dioxahexacyclo[10.5.1.02,15.05,14.06,11.013,17]octadeca-6,8,10-trien-3-yl]acetate |
| SMILES | CCOC(=O)CC1O[C@@H]2c3ccccc3[C@@H]3OC4C5CC(C14)C2C53 |
| InChI | InChI=1S/C20H22O4/c1-2-22-14(21)8-13-15-11-7-12-17-16(11)18(23-13)9-5-3-4-6-10(9)19(17)24-20(12)15/h3-6,11-13,15-20H,2,7-8H2,1H3/t11?,12?,13?,15?,16?,17?,18-,19+,20?/m1/s1 |
| InChIKey | KYLVHNDORULFTM-MORJMBPNSA-N |
| XLogP | 3.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |