C9H15NO3 — CID 167716905
ethyl 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-2-carboxylate (PubChem CID 167716905) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is ethyl 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-2-carboxylate.
| Compound Name | ethyl 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 167716905 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | ethyl 3,3a,4,5,6,6a-hexahydro-2H-furo[2,3-c]pyrrole-2-carboxylate |
| SMILES | CCOC(=O)C1CC2CNCC2O1 |
| InChI | InChI=1S/C9H15NO3/c1-2-12-9(11)7-3-6-4-10-5-8(6)13-7/h6-8,10H,2-5H2,1H3 |
| InChIKey | XTZYLIYCOLYPTP-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |