C25H40N2O8 — CID 171448380
N'-[4-(7-hydroxy-12-methyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-yl)cyclohexyl]-N-(4-methylcyclohexyl)propanediamide (PubChem CID 171448380) has the molecular formula C25H40N2O8 and a molecular weight of 496.60 g/mol. Its IUPAC name is N'-[4-(7-hydroxy-12-methyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-yl)cyclohexyl]-N-(4-methylcyclohexyl)propanediamide.
| Compound Name | N'-[4-(7-hydroxy-12-methyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-yl)cyclohexyl]-N-(4-methylcyclohexyl)propanediamide |
|---|---|
| PubChem CID | 171448380 |
| Molecular Formula | C25H40N2O8 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | N'-[4-(7-hydroxy-12-methyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-4-yl)cyclohexyl]-N-(4-methylcyclohexyl)propanediamide |
| SMILES | CC1CCC(NC(=O)CC(=O)NC2CCC(C3OC4C(O)OC5COC(C)OC5C4O3)CC2)CC1 |
| InChI | InChI=1S/C25H40N2O8/c1-13-3-7-16(8-4-13)26-19(28)11-20(29)27-17-9-5-15(6-10-17)25-34-22-21-18(12-31-14(2)32-21)33-24(30)23(22)35-25/h13-18,21-25,30H,3-12H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | YWQYLITXHWODCV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|