C25H38O10 — CID 171448439
[4-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]cyclohexanecarbonyl]oxymethyl 4-methylcyclohexane-1-carboxylate (PubChem CID 171448439) has the molecular formula C25H38O10 and a molecular weight of 498.57 g/mol. Its IUPAC name is [4-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]cyclohexanecarbonyl]oxymethyl 4-methylcyclohexane-1-carboxylate.
| Compound Name | [4-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]cyclohexanecarbonyl]oxymethyl 4-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 171448439 |
| Molecular Formula | C25H38O10 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | [4-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]cyclohexanecarbonyl]oxymethyl 4-methylcyclohexane-1-carboxylate |
| SMILES | CC1CCC(C(=O)OCOC(=O)C2CCC(C3OC4OC(C5COC(C)O5)C(O)C4O3)CC2)CC1 |
| InChI | InChI=1S/C25H38O10/c1-13-3-5-15(6-4-13)22(27)30-12-31-23(28)16-7-9-17(10-8-16)24-34-21-19(26)20(33-25(21)35-24)18-11-29-14(2)32-18/h13-21,24-26H,3-12H2,1-2H3 |
| InChIKey | ARAPUQKZGVBRFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|