C17H28N2O8 — CID 171448434
N-[[[2-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]acetyl]-methylamino]methyl]-N-methylpropanamide (PubChem CID 171448434) has the molecular formula C17H28N2O8 and a molecular weight of 388.42 g/mol. Its IUPAC name is N-[[[2-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]acetyl]-methylamino]methyl]-N-methylpropanamide.
| Compound Name | N-[[[2-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]acetyl]-methylamino]methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 171448434 |
| Molecular Formula | C17H28N2O8 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-[[[2-[6-hydroxy-5-(2-methyl-1,3-dioxolan-4-yl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-2-yl]acetyl]-methylamino]methyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)CN(C)C(=O)CC1OC2OC(C3COC(C)O3)C(O)C2O1 |
| InChI | InChI=1S/C17H28N2O8/c1-5-11(20)18(3)8-19(4)12(21)6-13-25-16-14(22)15(27-17(16)26-13)10-7-23-9(2)24-10/h9-10,13-17,22H,5-8H2,1-4H3 |
| InChIKey | HUKOZUAIUSMTRZ-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|