C13H23NOS — CID 107021547
N-(4-methylcyclohexyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide (PubChem CID 107021547) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide.
| Compound Name | N-(4-methylcyclohexyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
|---|---|
| PubChem CID | 107021547 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-(4-methylcyclohexyl)-2-[1-(sulfanylmethyl)cyclopropyl]acetamide |
| SMILES | CC1CCC(NC(=O)CC2(CS)CC2)CC1 |
| InChI | InChI=1S/C13H23NOS/c1-10-2-4-11(5-3-10)14-12(15)8-13(9-16)6-7-13/h10-11,16H,2-9H2,1H3,(H,14,15) |
| InChIKey | KSZFJKLNCNUNBB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|