C14H27NOS — CID 107026915
2-[1-(sulfanylmethyl)cyclopropyl]-N-(2,4,4-trimethylpentan-2-yl)acetamide (PubChem CID 107026915) has the molecular formula C14H27NOS and a molecular weight of 257.44 g/mol. Its IUPAC name is 2-[1-(sulfanylmethyl)cyclopropyl]-N-(2,4,4-trimethylpentan-2-yl)acetamide.
| Compound Name | 2-[1-(sulfanylmethyl)cyclopropyl]-N-(2,4,4-trimethylpentan-2-yl)acetamide |
|---|---|
| PubChem CID | 107026915 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-[1-(sulfanylmethyl)cyclopropyl]-N-(2,4,4-trimethylpentan-2-yl)acetamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CC1(CS)CC1 |
| InChI | InChI=1S/C14H27NOS/c1-12(2,3)9-13(4,5)15-11(16)8-14(10-17)6-7-14/h17H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | HESRVWWKWISWPT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|