C8H12O6 — CID 171620802
1-(4,7-dihydroxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-yl)ethanone (PubChem CID 171620802) has the molecular formula C8H12O6 and a molecular weight of 204.18 g/mol. Its IUPAC name is 1-(4,7-dihydroxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-yl)ethanone.
| Compound Name | 1-(4,7-dihydroxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-yl)ethanone |
|---|---|
| PubChem CID | 171620802 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 1-(4,7-dihydroxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2-yl)ethanone |
| SMILES | CC(=O)C1OC2C(O)COC(O)C2O1 |
| InChI | InChI=1S/C8H12O6/c1-3(9)8-13-5-4(10)2-12-7(11)6(5)14-8/h4-8,10-11H,2H2,1H3 |
| InChIKey | YXJHPGXASKIDMH-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |