C8H12O5 — CID 164917808
[(3R,3aR,5S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl] acetate (PubChem CID 164917808) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is [(3R,3aR,5S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl] acetate.
| Compound Name | [(3R,3aR,5S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 164917808 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | [(3R,3aR,5S,6aS)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]2OC[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C8H12O5/c1-4(9)12-7-2-6-8(13-7)5(10)3-11-6/h5-8,10H,2-3H2,1H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | VIVJFWZHVABLPV-ULAWRXDQSA-N |
| XLogP | -0.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |